should a buffers ph increase, decrease, or be unchanged by the addition of water? explain your answer

Answers

Answer 1

The pH of the buffer solution is relatively stable and does not change significantly upon the addition of small amounts of acid or base.

The pH of a buffer solution is determined by the equilibrium between a weak acid and its conjugate base or a weak base and its conjugate acid.  When water is added to a buffer solution, the concentration of the buffer components does not change, and the ratio of the weak acid and its conjugate base or weak base and its conjugate acid remains constant. Therefore, the pH of the buffer solution remains unchanged.

However, the addition of large amounts of water can dilute the buffer solution and cause a slight increase in pH due to the decrease in concentration of the buffer components. This effect is more pronounced in weaker buffer solutions. Therefore, in general, the pH of a buffer solution will remain relatively stable upon the addition of small amounts of water, but may increase slightly with the addition of large amounts of water.

To know more about the Buffer, here

https://brainly.com/question/30890340

#SPJ4


Related Questions

The ph curve ends with a ph of
A. 0-3
B. 4-7
C. 7-10
D. 11-14

Answers

The answer should be A. 0-3

when 7.5 x 10-4 g of koh is dissolved in 1.00 l of 1.0 x 10-10 m cu(no3)2, a precipitate of cu(oh)2 is formed. true or false? (ksp of cu(oh)2 is 2.2 x 10-20)

Answers

The given statement {When 7.5 x 10^-4 g of KOH is dissolved in 1.00 L of 1.0 x 10^-10 M Cu(NO3)2, a precipitate of Cu(OH)2 is formed} is True. This is because the Ksp of Cu(OH)2 (2.2 x 10^-20) is exceeded, leading to the formation of a precipitate. So the answer is true.

When 7.5 x 10-4 g of KOH is dissolved in 1.00 L of 1.0 x 10-10 M Cu(NO3)2, a precipitate of Cu(OH)2 is formed. This statement is true.

The equation is given below:

Cu(NO3)2 + 2KOH → Cu(OH)2 + 2KNO3, the given Ksp value for Cu(OH)2 is 2.2 x 10-20.

Molarity of Cu(NO3)2 is given by:

M = (1.0 x 10-10 mol/L) = moles of solute/L of solution= n/1.0 L1.0 x 10-10 = n/1.0 n = 1.0 x 10-10 mol

Amount of KOH is given by: Molarity of KOH = moles of solute/L of solution M = 7.5 x 10-4 g/(56.11 g/mol)/1.0 L= 1.336 x 10-5 mol/L, the balanced equation shows that the ratio of Cu(NO3)2 to KOH is 1:2.

Thus, moles of KOH = 2 x moles of Cu(NO3)2. Hence moles of Cu(NO3)2 = 1.0 x 10-10 mol/L x 1.0 L = 1.0 x 10-10 mol.

Moles of KOH = 2 x 1.0 x 10-10 mol = 2.0 x 10-10 mol.

Now we have the amount of both Cu(NO3)2 and KOH used in the reaction. The Ksp of Cu(OH)2 is given as 2.2 x 10-20.

The formula of Ksp is;

Ksp = [Cu2+][OH-]2Cu2+ and OH- are produced in a 1:2 molar ratio according to the balanced equation.

Therefore, [Cu2+] = 1.0 x 10-10 mol/L and [OH-] = 2 x 2.0 x 10-10 mol/L = 4.0 x 10-10 mol/L.

The value of Ksp is calculated as follows:

Ksp = [Cu2+][OH-]2= (1.0 x 10-10 mol/L)(4.0 x 10-10 mol/L)2= 1.6 x 10-28 mol3/L3.

This Ksp value is less than the given Ksp of Cu(OH)2 (2.2 x 10-20), which implies that a precipitate of Cu(OH)2 will form, and the statement is true.

For more questions on: KOH

https://brainly.com/question/31213916

#SPJ11  

14. Activities in the human body are represented in the diagram below Heat released from body by blood vessels dilating or by sweating Blood temperature decreases L Signals via blood ୮ Blood temperature increases L Brain Skin Skin Heat conserved by blood vessels constricting or by not sweating (Not drawn to scale) alel Ĵ "Too hot" Signals to skin via nerves "Too cold" Source: Campbell and Reece, Biology, 6th edition (adapted) Which title would be appropriate for the diagram? A) Rate of Excretion Varies in Response to Amount of Water Taken In B) Feedback Mechanisms Help to Maintain Homeostasis C) Respiratory Rate Responds to an Increase in Muscle Activity D) The Nervous System Responds to Changes in Blood Sugar Levels​

Answers

Heat manufacturing is a feature of metabolism. Most of the warmth produced in the body is generated in the liver, brain, heart, and skeletal muscle mass all through exercise.

What is the technique through which warmness is produced in human body?

In our body, cellular respiration leads to formation of water, carbon dioxide and launch of energy. This energy is stored in the shape of ATP. Some structure of this strength is utilised in day by day things to do and the excess is launched in the form of heat.

Which of the following is the method in which heat is misplaced from the body as wind passes over it?

Cooling Your Body

Convection happens when warmness is carried away from your body by means of shifting air. If the surrounding air is cooler than your skin, the air will absorb your heat and rise.

Learn more about human body here;

https://brainly.com/question/2844926

#SPJ9

In a titration, 25mL of 0.20M NaOH neutralize 5mL of HCI, what is the acid molarity?

Answers

The molarity of the HCl sample is 1.0 M.

In a titration, the moles of acid are equal to the moles of base at the equivalence point.

We can use this principle to calculate the molarity of the acid (HCl) from the volume and concentration of the base (NaOH) used in the titration.

First, we need to calculate the number of moles of NaOH used in the titration:

moles of NaOH = M x V = 0.20 M x 0.025 L = 0.005 mol

Since NaOH and HCl react in a 1:1 molar ratio, the number of moles of HCl present in the sample is also 0.005 mol.

Now we can calculate the molarity of HCl using the number of moles and the volume of the HCl sample used in the titration:

molarity of HCl = moles of HCl / volume of HCl sample

molarity of HCl = 0.005 mol / 0.005 L

molarity of HCl = 1.0 M

For more question on molarity click on

https://brainly.com/question/14469428

#SPJ11

what is the ph of a solution with a hydronium ion concentration of 0.01 mole per liter? * (1) 1 (2) 2 (3) 10 (4) 14

Answers

the pH of the given solution is 2.

pH is a measure of the acidity or alkalinity of a solution, and is defined as the negative logarithm (base 10) of the concentration of hydrogen ions (H+) in the solution. pH values range from 0 to 14, with a pH of 7 being neutral, a pH below 7 being acidic, and a pH above 7 being alkaline or basic.

A low pH value indicates a high concentration of hydrogen ions, which makes the solution acidic. A high pH value indicates a low concentration of hydrogen ions, which makes the solution basic. The pH scale is commonly used in many fields, including chemistry, biology, environmental science, and medicine, to describe and quantify the acidity or alkalinity of a solution.
The pH of a solution with a hydronium ion concentration of 0.01 mole per liter can be calculated using the formula:

pH = -log[H3O+]

where [H3O+] is the concentration of hydronium ions in moles per liter.

Substituting the given value, we get:

pH = -log(0.01)

Using a calculator, we get:

pH = 2

Therefore, the pH of the given solution is 2.

To know more about pH go through:-

https://brainly.com/question/172153

#SPJ4

various aspects of this experiment are time sensitive. preparing your samples and taking measurements too soon may yield inaccurate results because the reaction may not have reached equilibrium yet, and so on. to avoid that situation, a student prepares and mixes their solutions to start the reaction. they then make special arrangements to leave their solutions out on the lab bench all day and return that evening (6 hours later) to take their readings. considering the specific species present in the reaction, what, if anything, will the student notice about the absorbance results?

Answers

The student may observe a decrease in the absorbance results due to the reaction having reached equilibrium and the concentrations of the species involved having changed over time.

The specific species present in the reaction will determine the rate at which the reaction reaches equilibrium. If the reaction is slow to reach equilibrium, leaving the solutions out on the lab bench for only 6 hours may not be enough time for the reaction to fully proceed and reach equilibrium. This can result in inaccurate absorbance results due to incomplete reaction.

Conversely, if the reaction reaches equilibrium quickly, leaving the solutions out for 6 hours may not have a significant effect on the absorbance results. Therefore, it is important to consider the reaction kinetics and equilibrium characteristics of the specific species present in the reaction to ensure accurate absorbance readings.

To know more about absorbance, here

brainly.com/question/18042716

#SPJ4

--The complete question is, A student has prepared and mixed their solutions for an experiment, and left them on the lab bench for 6 hours before taking absorbance readings. What considerations should be made with regards to the specific species present in the reaction and how might this impact the accuracy of the absorbance results?--

what is the final volume of 5.31L of an ideal gas when heated from 200 K to 300 K at constant pressure?

Answers

The final volume of the gas is approximately 7.97 L. This type of process is often represented on a pressure-volume (PV) diagram as a horizontal line, where the pressure is constant and the volume changes.

What is Constant Pressure?

Constant pressure refers to a thermodynamic process where the pressure of the system remains constant throughout the process. This means that if a gas is undergoing a constant pressure process, its pressure will remain the same, but its volume, temperature, and other properties may change. In a constant pressure process, the system can exchange heat with its surroundings, but the pressure remains constant.

We can use Charles's Law to solve this problem, which states that at constant pressure, the volume of an ideal gas is directly proportional to its temperature in Kelvin.

We can set up a proportion:

(V₁/T₁) = (V₂/T₂)

where V₁ is the initial volume (5.31 L), T₁ is the initial temperature (200 K), V₂ is the final volume (what we want to find), and T₂ is the final temperature (300 K).

Solving for V₂:

V₂ = (V₁/T₁) x T₂

V₂ = (5.31 L / 200 K) x 300 K

V₂ = 7.965 L

Learn more about Constant Pressure from the given link

https://brainly.com/question/1480756

#SPJ1

what effect, if any, do you expect the three different substituents on the aromatic ring (para-chloro, para-methoxy, para-methyl) to have on the reaction? explain g

Answers

The para-methyl group is not expected to strongly influence the electronic properties of the ring but may affect its steric accessibility to reacting species.

the substituents on an aromatic ring can have a tremendous influence on the reactivity and selectivity of reactions that involve the ring in the case of the three unique substituents you noted para-chloro para-methoxy para-methyl they will probable have exceptional penalties on the response primarily based on their digital and steric properties para-chloro chlorine is an electron-withdrawing group which ability it will pull electrons away from the ring making it a whole lot much less electron-rich and extra inclined to electrophilic assault this can make the ring extra reactive closer to electrophilic fragrant substitution EAS reactions which comprise the addition of an electrophile to the ring the presence of a chlorine substituent can additionally have an impact on the regioselectivity of the reaction favoring substitution at the para role para-methoxy methoxy -och₃ is an electron-donating team which ability it will donate electrons to the ring making it greater electron-rich and much less susceptible to electrophilic assault this can make the ring plenty much less reactive in the direction of EAS reactions on the other hand the methoxy group can moreover increase the nucleophilicity of the ring making it more inclined to nucleophilic aromatic substitution NAS reactions the presence of a methoxy substituent can additionally have an effect on the regioselectivity of the reaction favoring substitution at the ortho and para positions para-methyl methyl -ch₃ is a as a substitute inert substituent that ability it does not strongly have an effect on the electron density of the ring or its reactivity toward EAS or NAS reactions however the presence of a methyl crew can affect the steric properties of the ring making it higher or a whole lot less on hand to the reacting species relying on the special reaction stipulations

learn more about aromatic ring here : brainly.com/question/28286554

#SPJ4

2. How are the electron arrangements in each pair of elements similar?
b) O and Se
a) Ba and Sr
c) N and As

Answers

Both Ba and Sr belong to the same group of elements in the periodic table Oxygen and selenium both belong to group 16 of the periodic table Nitrogen and arsenic belong to the same periodic table group of elements.

How do the electron arrangements of Ba and Sr contribute to their similar chemical properties?

Ba and Sr both have two valence electrons in their outermost shell and belong to the same group of elements in the periodic table, the alkaline earth metal group.

This similarity in electron arrangement leads to similar chemical properties.

What is the significance of nitrogen and arsenic belonging to the same group in the periodic table?

Nitrogen and arsenic belong to group 15 of the periodic table, also known as the nitrogen group. Both elements have five valence electrons in their outermost shell, and their shared electron arrangement contributes to similar chemical properties such as their ability to form compounds with three other atoms.

To know more about periodic table,visit:

https://brainly.com/question/11155928

#SPJ1

What is the minimum mass of Mg(NO₃)₂ that must be added to 1.00 L of a 0.560 M HF solution to begin precipitation of MgF₂(s)? For MgF₂, Ksp = 7.4 × 10⁻⁹, and Ka for HF = 7.2 × 10⁻⁴.

Answers

the minimum mass of Mg(NO₃)₂ required to begin precipitation of MgF₂ is 6.37 × 10⁻³ g/L.

The balanced equation for the precipitation of MgF₂ from Mg(NO₃)₂ and HF is:

Mg(NO₃)₂ + 2HF → MgF₂(s) + 2HNO₃

The concentration of fluoride ions can be found using the equilibrium expression for the dissociation of HF:

HF + H₂O ⇌ H₃O⁺ + F⁻

Ka = [H₃O⁺][F⁻]/[HF]

Since the initial concentration of HF is 0.560 M, the concentration of [H₃O⁺] is negligible compared to [HF] because HF is a weak acid. Therefore, we can simplify the expression to:

Ka = [F⁻][HF]/[HF] = [F⁻]

[F⁻] = Ka = 7.2 × 10⁻⁴ M

Now we need to determine the minimum amount of Mg(NO₃)₂ required to provide enough fluoride ions to reach the saturation point of MgF₂.

Let's assume x moles of Mg(NO₃)₂ is added to 1.00 L of 0.560 M HF solution. This will result in the addition of 2x moles of F⁻ ions to the solution.

The molar solubility of MgF₂ is equal to the square root of Ksp because the stoichiometric coefficients are 1 for both MgF₂ and Mg(NO₃)₂.

Molar solubility of MgF₂ = sqrt(Ksp) = sqrt(7.4 × 10⁻⁹) = 8.6 × 10⁻⁵ M

To reach saturation, the concentration of F⁻ ions must be equal to the molar solubility of MgF₂. Therefore:

[F⁻] = 8.6 × 10⁻⁵ M = 2x moles/L

x = 4.3 × 10⁻⁵ moles/L

The mass of Mg(NO₃)₂ required is then:

mass = moles × molar mass = (4.3 × 10⁻⁵ mol/L) × (148.3 g/mol) = 6.37 × 10⁻³ g/L.

Learn more about concentration here:

https://brainly.com/question/10725862

#SPJ1

the major source of indoor air pollution in developing countries is group of answer choices lead based paints on furniture and walls. cigarette smoke. synthetic materials in construction of buildings. indoor cooking with biomass as a fuel. release of radon-222 gas.

Answers

Indoor cooking with biomass fuel is the major source of indoor air pollution in developing countries, causing health risks.

The significant wellspring of indoor air contamination in emerging nations is indoor cooking with biomass as a fuel. Biomass fills, like wood, charcoal, and creature waste, are regularly utilized for cooking and warming in many non-industrial nations. Be that as it may, consuming these powers delivers a scope of poisons very high, including particulate matter, carbon monoxide, and nitrogen oxides, which can have serious wellbeing impacts.

Toxic paints on furnishings and walls, tobacco smoke, manufactured materials in development of structures, and arrival of radon-222 gas are additionally wellsprings of indoor air contamination, yet they are not as predominant in that frame of mind as indoor cooking with biomass fuel. Resolving this issue through clean cooking arrangements and advancing the utilization of cleaner powers can essentially further develop indoor air quality and decrease wellbeing gambles in these districts.

To learn more about biomass, refer:

https://brainly.com/question/28217240

#SPJ4

Why is it important for ocean to have various regions

Answers

Answer:

Explanation:

The ocean is a huge body of salt water that covers about 71 percent of Earth’s surface. The planet has one global ocean, though oceanographers and the countries of the world have traditionally divided it into four distinct regions: the Pacific, Atlantic, Indian, and Arctic oceans. Beginning in the 20th century, some oceanographers labeled the seas around Antarctica the Southern Ocean, and in 2021 National Geographic officially recognized this fifth ocean.

An estimated 97 percent of the world’s water is found in the ocean. Because of this, the ocean has a considerable impact on weather, temperature, and the food supply of humans and other organisms. Despite its size and impact on the lives of every organism on Earth, the ocean remains a mystery. More than 80 percent of the ocean has never been mapped, explored, or even seen by humans. A far greater percentage of the surfaces of the moon and the planet Mars has been mapped and studied than of our own ocean floor.

Although there is much more to learn, oceanographers have already made some amazing discoveries. For example, we know that the ocean contains towering mountain ranges and deep canyons, known as trenches, just like those on land. The peak of the world’s tallest mountain—Mount Everest in the Himalayas, measuring 8.84 kilometers (5.49 miles) high—would not even break the surface of the water if it was placed in the Pacific Ocean’s Mariana Trench or Philippine Trench, two of the deepest parts of the ocean.

each of the following is one of the major classes of outdoor pollutants except (mark all that apply) group of answer choices carbon oxides suspended particles nitrogen oxides sulfur oxides smog

Answers

Smog is a result of the interaction between different pollutants, it does not belong to the major classes of outdoor pollutants.


Let me briefly explain each major class of outdoor pollutant:

1. Carbon oxides: This group includes carbon monoxide (CO) and carbon dioxide (CO2). Carbon monoxide is a toxic gas produced by the incomplete combustion of fuels, while carbon dioxide is a greenhouse gas released from various human activities like the burning of fossil fuels.

2. Suspended particles: These are tiny solid or liquid particles suspended in the air, also known as particulate matter (PM). They can be emitted from various sources like construction activities, vehicle emissions, and industrial processes. Suspended particles can cause respiratory issues and other health problems.

3. Nitrogen oxides: This group includes nitrogen dioxide (NO2) and nitric oxide (NO), which are mainly emitted from vehicle exhausts and industrial processes. Nitrogen oxides contribute to the formation of smog, acid rain, and can cause respiratory problems.

4. Sulfur oxides: Sulfur dioxide (SO2) is the primary sulfur oxide, and it is released from burning fossil fuels, especially coal and oil, and from industrial processes. Sulfur oxides contribute to the formation of acid rain and can also cause respiratory problems.

for more questions on Smog :

https://brainly.com/question/2540988

#SPJ11

If the He in Problem 3 takes 20 sec to effuse, how long will NH3 take?

Answers

In Graham's law of effusion, the rate of effusion is inversely proportional to the square root of the molar mass of the gas.

The molar mass of NH3 is 17 g/mol.

Let's use the ratio of the square roots of the molar masses of He and NH3 to find the time it takes for NH3 to effuse:

(sqrt(Molar mass of He) / sqrt(Molar mass of NH3)) = sqrt(4 / 17)

So the rate of effusion of NH3 is:

(sqrt(Molar mass of NH3) / sqrt(Molar mass of He)) * (rate of effusion of He) = sqrt(17 / 4) * 3 = 3.67

Therefore, NH3 will take 3.67 times longer to effuse than He.

Time for NH3 = 20 sec × 3.67 = 73.4 sec.

So NH3 will take approximately 73.4 seconds to effuse.

part d.3. instead of conc nh, being added to the solution, 6 m naoh is added (both are bases). how will this affect the test for the identification of copper(ii) ion in the solution? explain.

Answers

We get the dark blue color precipitate which contains  [tex]Cu(NH3)4]^{2+}[/tex](aq.) complex ions of the solution when 6 M Na OH is added.

When the 6M Na OH is used instead of the NH3 in a solution then [tex]Cu^{2+}[/tex]ions will be precipitate out as the [tex]Cu(OH)_{2}[/tex]  in the solution. When the NH3 is used the [tex]Cu^{2+}[/tex] ions will form a complex with the NH3 in the solution which can be expressed as,

[tex]Cu^{2+}[/tex] + [tex]4NH_{3}[/tex] ----> [[tex]Cu(NH3)4]^{2+}[/tex] (aq.) + 2[tex]OH^{-}[/tex](aq.)

The complex of the [tex]Cu^{2+}[/tex]  is soluble which gives dark blue color to the solution.

Therefore by using the 6 M Na OH we can get the blue precipitate of the  [tex]Cu(OH)_{2}[/tex] . Precipitation is defined as the process of transforming a dissolved substance of the solution into an insoluble solid. The solid formed is called the precipitate of the solution.

and by using the NH3 we can get the dark blue color of the solution that contains  [tex]Cu(NH3)4]^{2+}[/tex](aq.) complex ions of the solution.

To learn more about Precipitate

https://brainly.com/question/30764379

#SPJ4

The correct question is,

Instead of conc. NH3 being added to the solution, 6 M Na OH is added (both are bases). How will this affect the test for the identification of copper(II) ion in the solution. Explain

you dissolve of the aminoacid leucine in a solution with . select the structure of the predominant form of the amino acid in solution?

Answers

Option a. CH, NH, CH, H-O. O. The predominant form of leucine in a physiological buffer with pH 7.40 is its zwitterionic form.

The predominant form of the amino acid leucine in a buffer with physiological pH (7.40) would be in its zwitterionic form, also known as the dipolar ion.

In this form, the amino group (-NH3+) is protonated and the carboxyl group (-COO-) is deprotonated, resulting in a molecule with both positive and negative charges. This zwitterionic form is more stable than the neutral or charged forms of the amino acid in aqueous solution due to the interactions between the charged functional groups.

The specific structure of leucine in its zwitterionic form can be represented as NH3+CH(CH3)CH2CH(NH2)COO-. Therefore, the answer would be option (a) CH3CH(NH3+)CH2COO-.

To learn more about predominant form, refer:

https://brainly.com/question/30781791

#SPJ4

The complete question is:

You dissolve 0.1 mol of the amino acid leucine in a buffer with physiological pH (7.40) and make 1L of solution. Select the structure of the predominant form of the amino acid in solution? NH, но, Q-COOH a-NH3 Leucine pl 2.32 9.58 ΝΗ, CH O (a) CH, NH, CH, H-O. O (b) wy CH ΝΗ, CH H-O O(C) CH NH' CH, O (d) yer CH

if a 0.25 m solution of a base is found to have a poh of 4.6 at equilibrium, what is the percent ionization of the base? select the correct answer below: 0.00010% 0.0010% 0.010% 0.10%

Answers

The percent ionization of the base is 0.010%. Option C is correct.

First, we can use the pOH value to find the pH of the solution;

pH + pOH = 14

pH = 14 - 4.6 = 9.4

Next, we can use the pH and the concentration of the solution to find the pKa of the conjugate acid of the base.

pH = pKa + log([A⁻]/[HA])

9.4 = pKa + log([A⁻]/[HA])

pKa = 9.4 - log([A⁻]/[HA])

Assuming the base is weak, we can also approximate the percent ionization using the equation;

% ionization = [A⁻]/[HA] x 100

Since the solution is 0.25 M, we can assume that [HA] = 0.25 M - [A-]. Substituting these values into the equation above and using the pKa we calculated, we get;

% ionization = [A⁻]/[HA] x 100

% ionization = [A⁻]/(0.25 M - [A⁻]) x 100

% ionization = [tex]10^{(-pKa +pH)}[/tex] x 100

% ionization = [tex]10^{(-9.4+4.6)}[/tex] x 100

% ionization = 0.010%

Hence, C. is the correct option.

To know more about percent ionization here

https://brainly.com/question/13161344

#SPJ4

--"The given question is incomplete, the complete question is

If a 0.25 m solution of a base is found to have a pOH of 4.6 at equilibrium, what is the percent ionization of the base? select the correct answer below: A) 0.00010% B) 0.0010% C) 0.010% D) 0.10%"--

a solution is prepared by adding 0.020 moles of na 2 hpo 4 and 0.010 moles of nah 2 po 4 to 100.0 ml of water. what is the ph of this solution? for h3 po 4 : ka1

Answers

The pH of the solution prepared by adding 0.020 moles of Na₂HPO₄ and 0.010 moles of NaH₂PO₄ to 100.0 ml of water is found to be 7.51.

A solution is prepared by adding 0.020 moles of Na₂HPO₄ and 0.010 moles of NaH₂PO₄ to 100.0 ml of water.

The total H⁺ concentration of the solution will be given as,

H⁺= √(Ka₁C₁)+(Ka₂C₂)

C₁ and C₂ are the concentration of the two acids. The Ka₁ and Ka₂ are the standard values of the solution. Putting all the values in the above mentioned formula we will get the pH of the solution to be 7.51.

To know more about pH of the solution, visit,

https://brainly.com/question/172153

#SPJ4

25.0 ml of 0.212 m naoh is neutralized by 13.6 ml of an hcl solution. the molarity of the hcl solution is . group of answer choices 0.115 m 0.212 m 0.137 m 0.390 m 0.500 m

Answers

The molarity of the HCl solution is approximately 0.390 M.

To find the molarity of the HCl solution, you can use the formula:

Molarity of acid(M2) x Volume of acid(V2) = Molarity of base(M1) x Volume of base(V1)

Molarity of acid(M2) = (Molarity of base(M1) x Volume of base(V1)) / Volume of acid(V2)

Therefore,

M1V1 = M2V2
where M1 and V1 are the molarity and volume of NaOH, and M2 and V2 are the molarity and volume of HCl.

Given:
M1 = 0.212 M (NaOH)
V1 = 25.0 mL (NaOH)
V2 = 13.6 mL (HCl)

You need to find M2 (molarity of HCl).

Step 1: Rearrange the formula to solve for M2:
M2 = (M1V1) / V2

Step 2: Plug in the given values:
M2 = (0.212 M * 25.0 mL) / 13.6 mL

Step 3: Calculate the result:
M2 ≈ 0.390 M

So, the molarity of the HCl solution is approximately 0.390 M.

Learn more about molarity here:

brainly.com/question/2817451

#SPJ11

Select the best answer for the question.
16. Which statement gives you enough information to say that the atom is electrically
neutral?
A. The atom has 15 neutrons and 15 electrons.
B. The atom has 19 electrons and 19 neutrons.
C. The atom has 7 protons and 7 electrons.
D. The atom has 4 neutrons and 4 protons.

Answers

When Muhammad died, his followers carried on the new religion. Islam prospered and grew under the Caliph Abu-Bakr and those who followed him. What cities became hubs of Muslim thought and power? How did word of this new religion spread? Did it appeal to people outside the Arabian Peninsula?

Explanation:

The correct answer is C. The statement "The atom has 7 protons and 7 electrons" gives enough information to say that the atom is electrically neutral. This is because the number of positively charged protons in the atom is equal to the number of negatively charged electrons, resulting in a net charge of zero. Option A and B both have an unequal number of electrons and protons, so the atom has a net charge. Option D also has an equal number of neutrons and protons but does not give information about the number of electrons.

Brass is an alloy of copper and zinc. The composition of a 1.00-g sample of brass is analyzed by reaction with excess 1.50 M HCl. The hydrogen gas produced is collected by water displacement. It is found to have a volume of 135 mL at 25 degrees Celsius and 772 torr. The vapor pressure of water at 25 degrees Celsius is 23.8 torr. Assume that only the zinc reacts. Determine the mass of zinc present in the brass sample.

Answers

The brass sample has 0.357 g of zinc.

What is mass?

The amount of inertia a body possesses and the resistance it provides to a change in its speed or position when a force is applied are measured by a body's mass, which is a fundamental attribute of matter. It is frequently used as a gauge for how much matter makes up a body and gives it weight in a gravitational field.

The chemical formula for the interaction of zinc with hydrochloric acid is as follows:

Zn(s) + 2HCl(aq) = ZnCl2(aq) + H2(g)

One mole of zinc interacts with two moles of hydrochloric acid to create one mole of hydrogen gas, as shown by the balancing chemical equation. As a result, the amount of zinc in the brass sample and the amount of hydrogen gas produced by the reaction are equal.

The ideal gas law can be used to determine how many moles of hydrogen gas were generated:

PV = nRT

where n is the number of moles, R is the gas constant, T is the temperature in Kelvin, and P is the total pressure of the gas.

Initially, we must adjust the hydrogen gas volume for the water vapor pressure. The gas's overall pressure is:

Total P = [tex]\rm P_ {H_2 }+ P_{H_2O}[/tex]

where  [tex]\rm P_ {H_2 } \ \texte{and }\ P_{H_2O}[/tex] are the partial pressures of hydrogen gas and water vapor, respectively.

P _H2O = 23.8 torr, as we know,

[tex]\rm P _{H_2[/tex] = [tex]\rm P_ {total[/tex] - [tex]\rm P _{H2O[/tex] = 772 torr – 23.8 torr= 748.2 torr.

Converting the volume to liters (L) and the pressure to atmospheres (atm):

P = 760 torr/atm / 748.2 torr = 0.984 atm

V=135 mL / 1000 mL/L = 0.135 L

The temperature must also be converted to Kelvin:

T = 25°C + 273.15 = 298.15 K

These values are substituted into the ideal gas law to find n.

n = PV/RT = (0.984 atm) × (0.135 L) / (0.08206 L·atm/mol·K) × (298.15 K) = 0.00547 mol H2.

When one mole of zinc interacts to create one mole of hydrogen gas, the brass sample also contains 0.00547 mol of zinc.

The molar mass of zinc (65.38 g/mol) can be used to calculate the mass of zinc in the brass sample.

mass of zinc = number of moles of zinc × molar mass of zinc

= 0.00547 mol × 65.38 g/mol

= 0.357 g

As a result, the brass sample has 0.357 g of zinc.

To know more about mass, visit:

brainly.com/question/19694949

#SPJ1

How many grams of O2 are required to react with 15.6 moles of CO2?

Answers

Answer: 499.2g of O2

Explanation:CO2 + O2 ---> CO2 +H20

From the equation, we know 1 mole of oxygen requires 1 mole of CO2 to react completely.

Therefore it is sure that 15.6 mole of CO2 requires 15.6 moles of O2

To convert moles of O2 to grams, we need to use the molar mass of O2

i.e. 32.00g/mol

the mass of O2 required is

15.6 moles *32.00 g/mol = 499.2g

when the temperature of ice-cold water is increased slightly, does it undergo a net expansion or a net contraction? group of answer choices neither contraction nor expansion expansion a combination of expansion (due to increased molecular motion) and contraction (due to crystal collapse) leads to a net expansion. contraction

Answers

The rate at which the water expands continues to increase until it reaches the freezing temperature of 0°C or 32°F.

When the temperature of ice-cold water is increased slightly, it undergoes a net contraction. In the case of water, the density of water is at a maximum at 4°C or 39°F. This implies that, as the temperature of water decreases, its density will increase until it reaches 4°C. As a result, the water will begin to expand again.

As a result, when the temperature of ice-cold water is increased slightly, it will undergo a net contraction.According to the Density Anomalies of Water experiment, as the temperature of water decreases, its density increases.

Water achieves its maximum density at 4°C or 39°F. When the temperature of water falls below 4°C, the water starts to expand. At this point, the water begins to freeze, causing a further expansion in volume.

To learn more about : temperature

https://brainly.com/question/4735135

#SPJ11

when 0.075 g of koh is dissolved in 1.00 l of 1.0 x 10-3 m cu(no3)2, a precipitate of cu(oh)2 is formed. true or false? (ksp of cu(oh)2 is 2.2 x 10-20)

Answers

It is true that when 7.5 x 10-4 g of KOH is dissolved in 1.00 L of 1.0 x 10-8 M Cu(NO3)2, a precipitate of Cu(OH)2 is formed. This is determined through the concept of Balanced chemical reaction.

The balanced chemical reaction can be written as,

2KOH(aq.) + [tex]Cu(NO_{3} )_{2}[/tex](aq.) ==> [tex]Cu(OH){2}[/tex](s) + [tex]2KNO_{3}[/tex](aq.)

moles KOH present can be calculated as,

   = 7.5x10-4 g x 1 mole/56.1 g

   = 1.33x10-5 moles KOH

   = 1.3x10-5 M OH-

moles[tex]Cu(NO_{3} )_{2}[/tex] present  can be calculated as,

          = 1.0x10-8 mole/L x 1 L

          = 1.0x10-8 moles Cu(NO3)2

          = 1x10-8 M Cu2+

[tex]Cu(OH){2}[/tex] (s) ==> Cu2+(aq.) + 2OH-(aq.)

Q = [Cu2+][OH-]2

Q = (1x10-8)(1.3x10-5)2

Q = 1.3x10-18

To learn more about balanced chemical reaction

https://brainly.com/question/26694427

#SPJ4

The correct question is,

When 7.5 x 10-4 g of KOH is dissolved in 1.00 L of 1.0 x 10-8 M Cu(NO3)2, a precipitate of Cu(OH)2 is formed. True or False? (Ksp of Cu(OH)2 is 2.2 x 10-20).

what do you still think about what determines the Moon's appearance from Earth?

Answers

Answer:

I think that the moon's rotation around the Earth shows us different parts of the moon

Explanation:

Answer:

The biggest clue to why the Moon always looks different when you look up at the sky is that it is constantly moving in relation to Earth and the Sun.

Explanation:

what is the uncertainty in the molarity of your edta titrant? show your worked out solution in the space provided below and enter your final answer for standard deviation and percent relative standard deviation.

Answers

The standard deviation and per cent relative standard deviation, which represent the uncertainty in the molarity of your EDTA titrant.

To calculate the uncertainty in the molarity of your EDTA titrant, we need some information about the measurements taken during the titration process. However, since the information is not provided, I will give you a general step-by-step guide to finding the uncertainty in molarity:
1. Record the volume measurements (in mL) for each titration trial.
2. Calculate the molarity of the EDTA titrant for each trial using the balanced equation of the reaction and the known molarity and volume of the analyte solution.
3. Find the mean (average) molarity of the EDTA titrant by summing the molarities calculated in step 2 and dividing by the total number of trials.
4. Calculate the deviation for each trial by subtracting the mean molarity from the molarity of each trial.
5. Square each deviation calculated in step 4.
6. Sum the squared deviations and divide by the total number of trials minus one (n-1) to find the variance.
7. Calculate the standard deviation by taking the square root of the variance.
8. Calculate the per cent relative standard deviation by dividing the standard deviation by the mean molarity and multiplying by 100.
After following these steps, you will have found the standard deviation and per cent relative standard deviation, which represents the uncertainty in the molarity of your EDTA titrant.

For more such questions on EDTA titrant.

brainly.com/question/30667405

#SPJ11

5.0 L of a gas goes from 1.0 atm to 1.3 atm. Calculate the final volume of this gas.

Answers

Answer: The heat capacity of a bomb calorimeter is 500 J°C.

what is the answer to the question?​

Answers

To determine the number of moles of reactants required to produce 6.2 moles of phosphoric acid (H₃PO₄), we need to use stoichiometry.

How many moles of reactant were required to form phosphoric acid?

From the balanced equation, we can see that 1 mole of P₄O₁₀ reacts with 6 moles of H₂O to produce 4 moles of H₃PO₄. This means that the ratio of P₄O₁₀ to H₃PO₄ is 1:4, and the ratio of H₂O to H₃PO₄ is 6:4, or 3:2.

To find the number of moles of P₄O₁₀ required, we can set up a proportion:

1 mole P₄O₁₀ / 4 moles H₃PO₄ = x moles P₄O₁₀ / 6.2 moles H₃PO₄

Solving for x, we get:

x = (1 mole P₄O₁₀ / 4 moles H₃PO₄ ) x (6.2 moles H₃PO₄ ) = 1.55 moles P₄O₁₀

Therefore, 1.55 moles of P₄O₁₀ were required to produce 6.2 moles of H₃PO₄.

To find the number of moles of  H₂O required, we can set up a similar proportion:

6 moles  H₂O/ 4 moles H₃PO₄ = x moles  H₂O/ 6.2 moles H₃PO₄

Solving for x, we get:

x = (6 moles  H₂O/ 4 moles H₃PO₄ ) x (6.2 moles H₃PO₄ ) = 9.3 moles  H₂O

Therefore, 9.3 moles of  H₂O were required to produce 6.2 moles of H₃PO₄ (phosphoric acid).

Learn more about phosphoric acid here:

https://brainly.com/question/3700851

#SPJ1

5
1 point
What volume of concentrated 18M solution is required to prepare 550 mL of a 2.0M solution?
Type your answer...
1 point
What volume of concentrated 1.5M is required to prepare 25 mL of a 7.0M solution?
Answer in liters

Answers

1-61.11 ml of the 18 M solution is required to prepare 550 ml of a 2.0 M solution.

2-0.117 liters or 117 ml of the 1.5 M solution is required to prepare 25 ml of a 7.0 M solution.

To calculate the volume of concentrated 18 M solution required to prepare 550 ml of a 2.0 M solution, we can use the formula:

M1V1 = M2V2

where:

M1 = 18 M (concentration of concentrated solution)

V1 = volume of concentrated solution to be added (unknown)

M2 = 2.0 M (final concentration required)

V2 = 550 ml (final volume required)

Rearranging the formula to solve for V1:

V1 = (M2 x V2) / M1

Substituting the values given:

V1 = (2.0 M x 550 ml) / 18 M

V1 = 61.11 ml

To calculate the volume of concentrated 1.5 M solution required to prepare 25 ml of a 7.0 M solution, we can again use the formula:

M1V1 = M2V2

where:

M1 = 1.5 M (concentration of concentrated solution)

V1 = volume of concentrated solution to be added (unknown)

M2 = 7.0 M (final concentration required)

V2 = 25 ml (final volume required)

Converting the final volume required to liters:

V2 = 25 ml = 0.025 L

Rearranging the formula to solve for V1:

V1 = (M2 x V2) / M1

Substituting the values given:

V1 = (7.0 M x 0.025 L) / 1.5 M

V1 = 0.117 L

Learn more about solution here:

https://brainly.com/question/30665317

#SPJ1

choose the transition state for the following SN2 reaction CI +NaSH ---> SH + NaCI. a) I B) II C) III D) IV

Answers

The transition state for the following SN2 reaction CI + NaSH ---> SH + NaCI is option III.

Transition state in a chemical reaction can be referred to as a molecular configuration that describes the point of maximum energy in the reaction path during which the bonds that are involved in the chemical reaction are in a state of change.

Transition state theory provides detailed explanations of the reaction rates and reaction mechanisms occurring in the gas phase.

The reaction mechanism in question is a substitution reaction in which the hydroxyl ion attacks the alkyl halide, resulting in the creation of an intermediate complex.

The complex is created in a transition state involving the transfer of a negatively charged ion, which will lead to a new bond forming with the incoming nucleophile.

In conclusion, the transition state for the following SN2 reaction CI + NaSH ---> SH + NaCI is option III.

To know more about transition state refer to-

brainly.com/question/30259181#

#SPJ11

Other Questions
6. Given the fact that a credit card balance can change every day, which of the followingbest describes how interest is calculated?Interest is calculated yearly using the total amount spent that year.Interest is calculated monthly but only on the carry-over balances.Interest is calculated monthly using the total amount spent that month.Interest is calculated using average daily balances.a.b.C.d. hich of the following statements describes the side effects of building a groin? they trap sand on the side facing the waves, but erosion can get worse on the downdrift side. they deflect wave energy onto the sand, increasing erosion overall. they trap sand on the downdrift side, but erosion can get worse on the side facing the waves. 1. Find the critical points for the graph ofy = 2x +22x + 48Write your answers as ordered pairs (x, y).y-intercept(s):x-intercept(s):vertex: identify the false statement about mixtures. please choose the correct answer from the following choices, and then select the submit answer button. answer choices a compound is not considered to be a mixture. a mixture must contain 2 or more pure substances. a mixture can contain compounds and/or elements. a mixture can be separated into its constituent components only by chemical means. A group of 25 students is asked to attend a meeting. 20 of the 25 students were able to attend. What percentage of the students were able to attend? (e) The table shows some information about an investigation on the decomposition of H2O2(aq) using two different catalysts. In each experiment, 0.100g of the catalyst and25.0 cm3 of H2O2(aq) were used. The concentration and temperature of the H2O2(aq) Use were kept constant.manganese(IV) oxide 25 95peroxidase 10For Examinerscatalysttime taken to collect 50 cm3 of oxygen / stotal volume of oxygen made at the end of the reaction / cm3 UCLES 20105070/21/M/J/10(i)(ii)What is the total volume of oxygen made at the end of the reaction in which peroxidase was used as a catalyst?volume of oxygen = ............................. cm3 client-centered therapy is based on the work of question 3 options: a) albert ellis. b) b.f. skinner. c) sigmund freud. d) carl rogers. When the internal energy of a system decreases by 300J while 100J of work is done on the system, what is the change in the heat for the system.A.-200B.+400C.-400D.+200 in a nutritious diet, the foods provide sufficient quantities of essential nutrients, fiber, and energy to maintain health and body weight. this principle of diet planning is called . 5 The first half of this article discusses the ideas of adaptation and natural selection. What specific example of these ideas does the second half of the article discuss? heparin sodium 10u/ml will be used for flushing the artery intraoperatively the vial reads heparin 10,000 u/ml. how much heparin will be added to 500ml magine that you are the governor of texas. you were elected in a landslide victory and have achieved what many are calling a popular mandate. what actions should you attempt in order to take advantage of this mandate? looking at the muscles at b and g, which are being stimulated to contract and which are being inhibited from contracting? Why, according to Kennedy, did the presence of the missiles pose a threat to the United States? A company had inventory of 5 units at a cost of $20 each on November 1. On November 2, it purchased 10 units at $22 each. On November 6 it purchased 6 units at $25 each. On November 8, it sold 18 units for $54 each. Using the LIFO perpetual inventory method, what was the cost of the 18 units sold? 1. Although Jack is a passionate camper, He finds the ___________ in this forest ___________. (DARK , BEAR).2. ___________ in at least two languages is essential if you want to work as an __________. ( FLUENT, INTERPRET).3. Her arguments are so ___________. We find it impossible to have a decent discussion with her. (LOGIC)4. Some ___________ were delayed because of the thick fog yesterday morning, causing growing ___________ among the passengers. (FLY, PATIENT)5. No one has ever measured the ___________ of this lake. (DEEP)6. The city council placed ___________ on the water supply due to a ___________ of water last year. (RESTRICT, SHORT)7. In several countries in the world, the percentage of ___________ is still very high. (LITERATE)8. If we want to calculate the area of the room, well have to multiply its ___________ by its ___________ . (LONG, WIDE).9. The judge banned him for a year from driving and told him it was ___________ to drink and drive. (RESPOND)10. This chocolate ___________ in ice-cream. (SPECIAL) processing data through the use of simulated files provides an auditor with information about the operating effectiveness of controls. one of the techniques involved in this approach makes use of program code checking. an integrated test facility. input validation. controlled reprocessing. lupita knows she must pay her plant floor workers overtime when they work more than 40 hours per week. she also knows that she does not have to pay her managers overtime; however, she is uncertain about her front-line supervisors and team leaders. which act should lupita review to find answers to this issue? Please help! I believe i need a paragraph what is the answer to two plus two minus three